C18H29N3O7 — CID 121439287
[[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] nonanoate (PubChem CID 121439287) has the molecular formula C18H29N3O7 and a molecular weight of 399.44 g/mol. Its IUPAC name is [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] nonanoate.
| Compound Name | [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] nonanoate |
|---|---|
| PubChem CID | 121439287 |
| Molecular Formula | C18H29N3O7 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] nonanoate |
| SMILES | CCCCCCCCC(=O)ONc1ccn(C2OC(CO)C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C18H29N3O7/c1-2-3-4-5-6-7-8-14(23)28-20-13-9-10-21(18(26)19-13)17-16(25)15(24)12(11-22)27-17/h9-10,12,15-17,22,24-25H,2-8,11H2,1H3,(H,19,20,26) |
| InChIKey | CAIBSWAHCOWADJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|