C17H28N4O7 — CID 137432663
[[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] N-heptylcarbamate (PubChem CID 137432663) has the molecular formula C17H28N4O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] N-heptylcarbamate.
| Compound Name | [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] N-heptylcarbamate |
|---|---|
| PubChem CID | 137432663 |
| Molecular Formula | C17H28N4O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)ONc1ccn(C2OC(CO)C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C17H28N4O7/c1-2-3-4-5-6-8-18-17(26)28-20-12-7-9-21(16(25)19-12)15-14(24)13(23)11(10-22)27-15/h7,9,11,13-15,22-24H,2-6,8,10H2,1H3,(H,18,26)(H,19,20,25) |
| InChIKey | ZJRPUCLPDWCNHM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|