C14H22N4O6 — CID 70233776
N-[3-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propyl]acetamide (PubChem CID 70233776) has the molecular formula C14H22N4O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[3-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propyl]acetamide.
| Compound Name | N-[3-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 70233776 |
| Molecular Formula | C14H22N4O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[3-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H22N4O6/c1-8(20)15-4-2-5-16-10-3-6-18(14(23)17-10)13-12(22)11(21)9(7-19)24-13/h3,6,9,11-13,19,21-22H,2,4-5,7H2,1H3,(H,15,20)(H,16,17,23)/t9-,11-,12-,13-/m1/s1 |
| InChIKey | CDFYNCRHJRFFOL-OJAKKHQRSA-N |
| XLogP | -2.21 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|