C27H45N3O6 — CID 13064697
(E)-N-[1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octadec-9-enamide (PubChem CID 13064697) has the molecular formula C27H45N3O6 and a molecular weight of 507.67 g/mol. Its IUPAC name is (E)-N-[1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octadec-9-enamide.
| Compound Name | (E)-N-[1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 13064697 |
| Molecular Formula | C27H45N3O6 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | (E)-N-[1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C27H45N3O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(32)28-22-18-19-30(27(35)29-22)26-25(34)24(33)21(20-31)36-26/h9-10,18-19,21,24-26,31,33-34H,2-8,11-17,20H2,1H3,(H,28,29,32,35)/b10-9+/t21-,24-,25+,26-/m1/s1 |
| InChIKey | CDONIXJIKOVUIH-FNNZEKJRSA-N |
| XLogP | 3.83 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|