C17H28N5O5P — CID 14775402
4-[bis(2,2-dimethylaziridin-1-yl)phosphorylamino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 14775402) has the molecular formula C17H28N5O5P and a molecular weight of 413.42 g/mol. Its IUPAC name is 4-[bis(2,2-dimethylaziridin-1-yl)phosphorylamino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-[bis(2,2-dimethylaziridin-1-yl)phosphorylamino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 14775402 |
| Molecular Formula | C17H28N5O5P |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 4-[bis(2,2-dimethylaziridin-1-yl)phosphorylamino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC1(C)CN1P(=O)(Nc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1)N1CC1(C)C |
| InChI | InChI=1S/C17H28N5O5P/c1-16(2)9-21(16)28(26,22-10-17(22,3)4)19-13-5-6-20(15(25)18-13)14-7-11(24)12(8-23)27-14/h5-6,11-12,14,23-24H,7-10H2,1-4H3,(H,18,19,25,26)/t11-,12+,14+,21?,22?,28?/m0/s1 |
| InChIKey | VICBCLZTPWIZBW-ZGXBXBPPSA-N |
| XLogP | 0.59 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|