C15H26N4O4 — CID 14698388
4-(6-aminohexylamino)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 14698388) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-(6-aminohexylamino)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-(6-aminohexylamino)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 14698388 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-(6-aminohexylamino)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | NCCCCCCNc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C15H26N4O4/c16-6-3-1-2-4-7-17-13-5-8-19(15(22)18-13)14-9-11(21)12(10-20)23-14/h5,8,11-12,14,20-21H,1-4,6-7,9-10,16H2,(H,17,18,22)/t11-,12+,14+/m0/s1 |
| InChIKey | OVUKZURUFLDHKA-OUCADQQQSA-N |
| XLogP | -0.19 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|