C17H29N5O5 — CID 67943879
4-[(2,8-diamino-3-oxooctyl)amino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 67943879) has the molecular formula C17H29N5O5 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[(2,8-diamino-3-oxooctyl)amino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-[(2,8-diamino-3-oxooctyl)amino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 67943879 |
| Molecular Formula | C17H29N5O5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-[(2,8-diamino-3-oxooctyl)amino]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | NCCCCCC(=O)C(N)CNc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C17H29N5O5/c18-6-3-1-2-4-12(24)11(19)9-20-15-5-7-22(17(26)21-15)16-8-13(25)14(10-23)27-16/h5,7,11,13-14,16,23,25H,1-4,6,8-10,18-19H2,(H,20,21,26)/t11?,13-,14+,16+/m0/s1 |
| InChIKey | OVRSGFNDMYEAGS-QYEAHEDKSA-N |
| XLogP | -1.29 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|