C12H16N4O4 — CID 10779105
3-[[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propanenitrile (PubChem CID 10779105) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 10779105 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-[[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]propanenitrile |
| SMILES | N#CCCNc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C12H16N4O4/c13-3-1-4-14-10-2-5-16(12(19)15-10)11-6-8(18)9(7-17)20-11/h2,5,8-9,11,17-18H,1,4,6-7H2,(H,14,15,19)/t8-,9+,11+/m0/s1 |
| InChIKey | VYQJZBXNOKRICF-IQJOONFLSA-N |
| XLogP | -0.79 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|