C31H34N4O5 — CID 11753081
4-(2-aminoethylamino)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 11753081) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-(2-aminoethylamino)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 11753081 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 4-(2-aminoethylamino)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NCCN)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N4O5/c1-38-25-14-12-24(13-15-25)31(22-8-4-2-5-9-22,23-10-6-3-7-11-23)39-21-27-26(36)20-29(40-27)35-19-16-28(33-18-17-32)34-30(35)37/h2-16,19,26-27,29,36H,17-18,20-21,32H2,1H3,(H,33,34,37)/t26-,27+,29+/m0/s1 |
| InChIKey | MJJYMZLLUSIPDE-YIKNKFAXSA-N |
| XLogP | 3.28 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|