C49H45N3O6 — CID 11803320
1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one (PubChem CID 11803320) has the molecular formula C49H45N3O6 and a molecular weight of 771.91 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 11803320 |
| Molecular Formula | C49H45N3O6 |
| Molecular Weight | 771.91 g/mol |
| Exact Mass | 771.33 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one |
| SMILES | COc1ccc(C(Nc2ccn([C@H]3C[C@H](OC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)[C@@H](CO)O3)c(=O)n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H45N3O6/c1-55-41-27-23-37(24-28-41)48(35-15-7-3-8-16-35,36-17-9-4-10-18-36)51-45-31-32-52(47(54)50-45)46-33-43(44(34-53)57-46)58-49(38-19-11-5-12-20-38,39-21-13-6-14-22-39)40-25-29-42(56-2)30-26-40/h3-32,43-44,46,53H,33-34H2,1-2H3,(H,50,51,54)/t43-,44+,46+/m0/s1 |
| InChIKey | WIECTFCEWRODIE-UFCNIINJSA-N |
| XLogP | 8.32 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.91 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|