C38H36N4O6 — CID 126564045
(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-[4-(hydroxymethyl)phenyl]purin-9-yl]oxolan-3-ol (PubChem CID 126564045) has the molecular formula C38H36N4O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-[4-(hydroxymethyl)phenyl]purin-9-yl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-[4-(hydroxymethyl)phenyl]purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 126564045 |
| Molecular Formula | C38H36N4O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-[4-(hydroxymethyl)phenyl]purin-9-yl]oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(-c5ccc(CO)cc5)ncnc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H36N4O6/c1-45-30-16-12-28(13-17-30)38(27-6-4-3-5-7-27,29-14-18-31(46-2)19-15-29)47-22-33-32(44)20-34(48-33)42-24-41-36-35(39-23-40-37(36)42)26-10-8-25(21-43)9-11-26/h3-19,23-24,32-34,43-44H,20-22H2,1-2H3/t32-,33+,34+/m0/s1 |
| InChIKey | TWUPWQIEBCPGLU-LBFZIJHGSA-N |
| XLogP | 5.66 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|