C30H29N5O4 — CID 21338227
(2S,3S,5R)-2-(hydroxymethyl)-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-3-ol (PubChem CID 21338227) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is (2S,3S,5R)-2-(hydroxymethyl)-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-3-ol.
| Compound Name | (2S,3S,5R)-2-(hydroxymethyl)-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 21338227 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (2S,3S,5R)-2-(hydroxymethyl)-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-3-ol |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3[C@H]2C[C@H](O)[C@H](CO)O2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N5O4/c1-38-23-14-12-22(13-15-23)30(20-8-4-2-5-9-20,21-10-6-3-7-11-21)34-28-27-29(32-18-31-28)35(19-33-27)26-16-24(37)25(17-36)39-26/h2-15,18-19,24-26,36-37H,16-17H2,1H3,(H,31,32,34)/t24-,25-,26+/m0/s1 |
| InChIKey | MRVSQBLEOUUZLR-KKUQBAQOSA-N |
| XLogP | 3.88 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|