C33H35N5O2 — CID 59637536
9-[(2R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine (PubChem CID 59637536) has the molecular formula C33H35N5O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 9-[(2R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
|---|---|
| PubChem CID | 59637536 |
| Molecular Formula | C33H35N5O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 9-[(2R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)ncnc32)C(C)C1C |
| InChI | InChI=1S/C33H35N5O2/c1-5-28-22(2)23(3)32(40-28)38-21-36-29-30(34-20-35-31(29)38)37-33(24-12-8-6-9-13-24,25-14-10-7-11-15-25)26-16-18-27(39-4)19-17-26/h6-23,28,32H,5H2,1-4H3,(H,34,35,37)/t22?,23?,28-,32-/m1/s1 |
| InChIKey | VVEJPHBVBNGMBS-MBPUFVAZSA-N |
| XLogP | 6.82 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|