C33H34N8O3 — CID 158524872
9-[(2R,3R,4R,5R)-4-azido-3-ethoxy-5-ethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine (PubChem CID 158524872) has the molecular formula C33H34N8O3 and a molecular weight of 590.69 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-4-azido-3-ethoxy-5-ethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-4-azido-3-ethoxy-5-ethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
|---|---|
| PubChem CID | 158524872 |
| Molecular Formula | C33H34N8O3 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-4-azido-3-ethoxy-5-ethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
| SMILES | CCO[C@@H]1[C@H](N=[N+]=[N-])[C@@H](CC)O[C@H]1n1cnc2c(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)ncnc21 |
| InChI | InChI=1S/C33H34N8O3/c1-4-26-27(39-40-34)29(43-5-2)32(44-26)41-21-37-28-30(35-20-36-31(28)41)38-33(22-12-8-6-9-13-22,23-14-10-7-11-15-23)24-16-18-25(42-3)19-17-24/h6-21,26-27,29,32H,4-5H2,1-3H3,(H,35,36,38)/t26-,27-,29-,32-/m1/s1 |
| InChIKey | SWWDJUCDTPNUHM-UUEOAETPSA-N |
| XLogP | 6.63 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|