C33H31N5O6 — CID 153285900
[(2R,4S,5R)-4-acetyloxy-2-(hydroxymethyl)-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate (PubChem CID 153285900) has the molecular formula C33H31N5O6 and a molecular weight of 593.64 g/mol. Its IUPAC name is [(2R,4S,5R)-4-acetyloxy-2-(hydroxymethyl)-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-4-acetyloxy-2-(hydroxymethyl)-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 153285900 |
| Molecular Formula | C33H31N5O6 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | [(2R,4S,5R)-4-acetyloxy-2-(hydroxymethyl)-5-[6-(tritylamino)purin-9-yl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](CO)O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H31N5O6/c1-21(40)42-28-26(18-39)44-32(29(28)43-22(2)41)38-20-36-27-30(34-19-35-31(27)38)37-33(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,19-20,26,28-29,32,39H,18H2,1-2H3,(H,34,35,37)/t26-,28?,29+,32-/m1/s1 |
| InChIKey | FPYIXJTTZQVQKM-NUVXJVDYSA-N |
| XLogP | 3.98 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|