C52H45N5O6 — CID 172710212
2-[(2R,3R,4R,5R)-4-(carboxymethyl)-5-[6-(tritylamino)purin-9-yl]-2-(trityloxymethyl)oxolan-3-yl]acetic acid (PubChem CID 172710212) has the molecular formula C52H45N5O6 and a molecular weight of 835.96 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-4-(carboxymethyl)-5-[6-(tritylamino)purin-9-yl]-2-(trityloxymethyl)oxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,5R)-4-(carboxymethyl)-5-[6-(tritylamino)purin-9-yl]-2-(trityloxymethyl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 172710212 |
| Molecular Formula | C52H45N5O6 |
| Molecular Weight | 835.96 g/mol |
| Exact Mass | 835.34 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-4-(carboxymethyl)-5-[6-(tritylamino)purin-9-yl]-2-(trityloxymethyl)oxolan-3-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](CC(=O)O)[C@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)O[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H45N5O6/c58-45(59)31-42-43(32-46(60)61)50(63-44(42)33-62-52(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41)57-35-55-47-48(53-34-54-49(47)57)56-51(36-19-7-1-8-20-36,37-21-9-2-10-22-37)38-23-11-3-12-24-38/h1-30,34-35,42-44,50H,31-33H2,(H,58,59)(H,60,61)(H,53,54,56)/t42-,43-,44+,50-/m1/s1 |
| InChIKey | FDLOHCIHKHFWHD-UJVKKVIBSA-N |
| XLogP | 9.32 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.96 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|