C52H49N5O8 — CID 139886209
(2R,3S,4R,5R)-2-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-5-[6-[[(2,3-dimethoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 139886209) has the molecular formula C52H49N5O8 and a molecular weight of 871.99 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-5-[6-[[(2,3-dimethoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-5-[6-[[(2,3-dimethoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139886209 |
| Molecular Formula | C52H49N5O8 |
| Molecular Weight | 871.99 g/mol |
| Exact Mass | 871.36 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-5-[6-[[(2,3-dimethoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | COc1cccc(C(Nc2ncnc3c2ncn3[C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3cccc(OC)c3OC)[C@@H](O)[C@H]2O)(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C52H49N5O8/c1-60-40-29-17-27-38(46(40)62-3)51(34-19-9-5-10-20-34,35-21-11-6-12-22-35)56-48-43-49(54-32-53-48)57(33-55-43)50-45(59)44(58)42(65-50)31-64-52(36-23-13-7-14-24-36,37-25-15-8-16-26-37)39-28-18-30-41(61-2)47(39)63-4/h5-30,32-33,42,44-45,50,58-59H,31H2,1-4H3,(H,53,54,56)/t42-,44-,45-,50-/m1/s1 |
| InChIKey | INCAKMJPJWLBEI-HWIJQJHWSA-N |
| XLogP | 7.89 |
| TPSA | 151.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.99 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|