C38H36FN5O7 — CID 140552355
N-[9-[(2R,3R,4S,5R)-5-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-(2-fluorophenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 140552355) has the molecular formula C38H36FN5O7 and a molecular weight of 693.73 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-(2-fluorophenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-(2-fluorophenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 140552355 |
| Molecular Formula | C38H36FN5O7 |
| Molecular Weight | 693.73 g/mol |
| Exact Mass | 693.26 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-(2-fluorophenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COC1(OC)C=CC(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](O)[C@@H]2O)(c2ccccc2)c2ccccc2F)=CC1 |
| InChI | InChI=1S/C38H36FN5O7/c1-48-37(49-2)19-17-26(18-20-37)38(25-13-7-4-8-14-25,27-15-9-10-16-28(27)39)50-21-29-31(45)32(46)36(51-29)44-23-42-30-33(40-22-41-34(30)44)43-35(47)24-11-5-3-6-12-24/h3-19,22-23,29,31-32,36,45-46H,20-21H2,1-2H3,(H,40,41,43,47)/t29-,31-,32-,36-,38?/m1/s1 |
| InChIKey | QAERUSPOBHKHHU-HAVYRWSWSA-N |
| XLogP | 4.67 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|