C37H33N5O4 — CID 57292552
N-[9-[(2R,3R,4S)-4-(methoxymethyl)-3-(trityloxymethyl)oxetan-2-yl]purin-6-yl]benzamide (PubChem CID 57292552) has the molecular formula C37H33N5O4 and a molecular weight of 611.70 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S)-4-(methoxymethyl)-3-(trityloxymethyl)oxetan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S)-4-(methoxymethyl)-3-(trityloxymethyl)oxetan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 57292552 |
| Molecular Formula | C37H33N5O4 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | N-[9-[(2R,3R,4S)-4-(methoxymethyl)-3-(trityloxymethyl)oxetan-2-yl]purin-6-yl]benzamide |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H33N5O4/c1-44-23-31-30(22-45-37(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29)36(46-31)42-25-40-32-33(38-24-39-34(32)42)41-35(43)26-14-6-2-7-15-26/h2-21,24-25,30-31,36H,22-23H2,1H3,(H,38,39,41,43)/t30-,31-,36-/m1/s1 |
| InChIKey | REIJLEVTCMUJPQ-PCJZJSDKSA-N |
| XLogP | 6.25 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|