C38H35N5O2 — CID 158644304
N-[9-[(1R,2R,3S)-3-ethyl-2-(trityloxymethyl)cyclobutyl]purin-6-yl]benzamide (PubChem CID 158644304) has the molecular formula C38H35N5O2 and a molecular weight of 593.73 g/mol. Its IUPAC name is N-[9-[(1R,2R,3S)-3-ethyl-2-(trityloxymethyl)cyclobutyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1R,2R,3S)-3-ethyl-2-(trityloxymethyl)cyclobutyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 158644304 |
| Molecular Formula | C38H35N5O2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | N-[9-[(1R,2R,3S)-3-ethyl-2-(trityloxymethyl)cyclobutyl]purin-6-yl]benzamide |
| SMILES | CC[C@H]1C[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H35N5O2/c1-2-27-23-33(43-26-41-34-35(39-25-40-36(34)43)42-37(44)28-15-7-3-8-16-28)32(27)24-45-38(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31/h3-22,25-27,32-33H,2,23-24H2,1H3,(H,39,40,42,44)/t27-,32+,33+/m0/s1 |
| InChIKey | IATUABWRNJTDNK-SKTNCWGXSA-N |
| XLogP | 7.67 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|