C39H37N5O4 — CID 14254918
N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopentyl]purin-6-yl]benzamide (PubChem CID 14254918) has the molecular formula C39H37N5O4 and a molecular weight of 639.76 g/mol. Its IUPAC name is N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopentyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopentyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 14254918 |
| Molecular Formula | C39H37N5O4 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopentyl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OCC2CCC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H37N5O4/c1-46-33-19-14-30(15-20-33)39(29-11-7-4-8-12-29,31-16-21-34(47-2)22-17-31)48-24-27-13-18-32(23-27)44-26-42-35-36(40-25-41-37(35)44)43-38(45)28-9-5-3-6-10-28/h3-12,14-17,19-22,25-27,32H,13,18,23-24H2,1-2H3,(H,40,41,43,45) |
| InChIKey | JQUVMTXRAUTMOI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|