C39H35N5O4 — CID 150293364
N-[9-[(1R,2S,3S)-2-(hydroxymethyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-methylidenecyclobutyl]purin-6-yl]benzamide (PubChem CID 150293364) has the molecular formula C39H35N5O4 and a molecular weight of 637.74 g/mol. Its IUPAC name is N-[9-[(1R,2S,3S)-2-(hydroxymethyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-methylidenecyclobutyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1R,2S,3S)-2-(hydroxymethyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-methylidenecyclobutyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 150293364 |
| Molecular Formula | C39H35N5O4 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | N-[9-[(1R,2S,3S)-2-(hydroxymethyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-methylidenecyclobutyl]purin-6-yl]benzamide |
| SMILES | C=C1[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)[C@H](CO)[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C39H35N5O4/c1-26-33(23-48-39(28-14-8-4-9-15-28,29-16-10-5-11-17-29)30-18-20-31(47-2)21-19-30)32(22-45)35(26)44-25-42-34-36(40-24-41-37(34)44)43-38(46)27-12-6-3-7-13-27/h3-21,24-25,32-33,35,45H,1,22-23H2,2H3,(H,40,41,43,46)/t32-,33+,35-/m0/s1 |
| InChIKey | GIBLDGQLQMERAJ-UJNSZXMOSA-N |
| XLogP | 6.43 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|