C35H37N5O3Si — CID 156903552
N-[9-[(1S,2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-4-methylidenecyclobutyl]purin-6-yl]benzamide (PubChem CID 156903552) has the molecular formula C35H37N5O3Si and a molecular weight of 603.80 g/mol. Its IUPAC name is N-[9-[(1S,2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-4-methylidenecyclobutyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1S,2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-4-methylidenecyclobutyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 156903552 |
| Molecular Formula | C35H37N5O3Si |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | N-[9-[(1S,2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-4-methylidenecyclobutyl]purin-6-yl]benzamide |
| SMILES | C=C1[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](CO)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H37N5O3Si/c1-24-29(21-43-44(35(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27)28(20-41)31(24)40-23-38-30-32(36-22-37-33(30)40)39-34(42)25-14-8-5-9-15-25/h5-19,22-23,28-29,31,41H,1,20-21H2,2-4H3,(H,36,37,39,42)/t28-,29+,31-/m1/s1 |
| InChIKey | AFDFFAYERGOZOS-ATNBEAFSSA-N |
| XLogP | 4.99 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|