C43H43N5O6Si — CID 101263194
[(2S,3aS,5R,6R,6aR)-2-(6-benzamidopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a-phenyl-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate (PubChem CID 101263194) has the molecular formula C43H43N5O6Si and a molecular weight of 753.93 g/mol. Its IUPAC name is [(2S,3aS,5R,6R,6aR)-2-(6-benzamidopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a-phenyl-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate.
| Compound Name | [(2S,3aS,5R,6R,6aR)-2-(6-benzamidopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a-phenyl-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 101263194 |
| Molecular Formula | C43H43N5O6Si |
| Molecular Weight | 753.93 g/mol |
| Exact Mass | 753.30 |
| IUPAC Name | [(2S,3aS,5R,6R,6aR)-2-(6-benzamidopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a-phenyl-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@]2(c2ccccc2)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H43N5O6Si/c1-29(49)52-37-34(26-51-55(42(2,3)4,32-21-13-7-14-22-32)33-23-15-8-16-24-33)54-43(31-19-11-6-12-20-31)25-35(53-38(37)43)48-28-46-36-39(44-27-45-40(36)48)47-41(50)30-17-9-5-10-18-30/h5-24,27-28,34-35,37-38H,25-26H2,1-4H3,(H,44,45,47,50)/t34-,35+,37-,38-,43+/m1/s1 |
| InChIKey | DEQWIHYGMCAXFS-CMZZFHODSA-N |
| XLogP | 6.17 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.93 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|