C42H42BrN3O7Si — CID 11520675
[(2S,3aS,5R,6R,6aR)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate (PubChem CID 11520675) has the molecular formula C42H42BrN3O7Si and a molecular weight of 808.80 g/mol. Its IUPAC name is [(2S,3aS,5R,6R,6aR)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate.
| Compound Name | [(2S,3aS,5R,6R,6aR)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 11520675 |
| Molecular Formula | C42H42BrN3O7Si |
| Molecular Weight | 808.80 g/mol |
| Exact Mass | 807.20 |
| IUPAC Name | [(2S,3aS,5R,6R,6aR)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@]2(c2cccc(Br)c2)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H42BrN3O7Si/c1-28(47)51-37-34(27-50-54(41(2,3)4,32-19-10-6-11-20-32)33-21-12-7-13-22-33)53-42(30-17-14-18-31(43)25-30)26-36(52-38(37)42)46-24-23-35(45-40(46)49)44-39(48)29-15-8-5-9-16-29/h5-25,34,36-38H,26-27H2,1-4H3,(H,44,45,48,49)/t34-,36+,37-,38-,42+/m1/s1 |
| InChIKey | QUKJQIAVDIXLEZ-SSANWCDGSA-N |
| XLogP | 6.35 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.80 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|