C33H37BrO7Si — CID 11679082
[(3aS,5R,6R,6aR)-6-acetyloxy-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl] acetate (PubChem CID 11679082) has the molecular formula C33H37BrO7Si and a molecular weight of 653.64 g/mol. Its IUPAC name is [(3aS,5R,6R,6aR)-6-acetyloxy-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl] acetate.
| Compound Name | [(3aS,5R,6R,6aR)-6-acetyloxy-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 11679082 |
| Molecular Formula | C33H37BrO7Si |
| Molecular Weight | 653.64 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | [(3aS,5R,6R,6aR)-6-acetyloxy-3a-(3-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@]2(c3cccc(Br)c3)O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OC(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C33H37BrO7Si/c1-22(35)38-29-20-33(24-13-12-14-25(34)19-24)31(40-29)30(39-23(2)36)28(41-33)21-37-42(32(3,4)5,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-19,28-31H,20-21H2,1-5H3/t28-,29?,30-,31-,33+/m1/s1 |
| InChIKey | HOLRCTWSDDFTCZ-UTLWTRNISA-N |
| XLogP | 5.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|