C26H34O7Si — CID 58592657
[(2S,3R,5R)-4-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 58592657) has the molecular formula C26H34O7Si and a molecular weight of 486.64 g/mol. Its IUPAC name is [(2S,3R,5R)-4-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2S,3R,5R)-4-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58592657 |
| Molecular Formula | C26H34O7Si |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(2S,3R,5R)-4-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](CO)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H34O7Si/c1-18(28)31-24-22(16-27)33-23(25(24)32-19(2)29)17-30-34(26(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22-25,27H,16-17H2,1-5H3/t22-,23+,24+,25?/m0/s1 |
| InChIKey | SJKCYVJHWULXRI-QPDXQIEMSA-N |
| XLogP | 2.19 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|