C23H29BO5Si — CID 88569468
CID 88569468 (PubChem CID 88569468) has the molecular formula C23H29BO5Si and a molecular weight of 424.38 g/mol.
| Compound Name | CID 88569468 |
|---|---|
| PubChem CID | 88569468 |
| Molecular Formula | C23H29BO5Si |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CO)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29BO5Si/c1-16(26)27-21-20(19(15-25)28-22(21)24)29-30(23(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-22,25H,15H2,1-4H3/t19-,20-,21+,22-/m1/s1 |
| InChIKey | BKCNVFJZJDFAEQ-YUMYIRISSA-N |
| XLogP | 1.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|