C24H31BrO5Si — CID 171124282
[(2S,5R,6R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 171124282) has the molecular formula C24H31BrO5Si and a molecular weight of 507.50 g/mol. Its IUPAC name is [(2S,5R,6R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,5R,6R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 171124282 |
| Molecular Formula | C24H31BrO5Si |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [(2S,5R,6R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(Br)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)O[C@H]1C |
| InChI | InChI=1S/C24H31BrO5Si/c1-16-21(29-17(2)26)20(25)22(23(27)28-16)30-31(24(3,4)5,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-16,20-23,27H,1-5H3/t16-,20?,21?,22-,23+/m0/s1 |
| InChIKey | FORMMTRULHPFFJ-ACCQCVQPSA-N |
| XLogP | 3.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|