C38H47IO4Si2 — CID 171125346
(2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-ol (PubChem CID 171125346) has the molecular formula C38H47IO4Si2 and a molecular weight of 750.87 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-ol.
| Compound Name | (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-ol |
|---|---|
| PubChem CID | 171125346 |
| Molecular Formula | C38H47IO4Si2 |
| Molecular Weight | 750.87 g/mol |
| Exact Mass | 750.21 |
| IUPAC Name | (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-ol |
| SMILES | C[C@H]1O[C@H](O)[C@@H](I)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H47IO4Si2/c1-28-34(42-44(37(2,3)4,29-20-12-8-13-21-29)30-22-14-9-15-23-30)35(33(39)36(40)41-28)43-45(38(5,6)7,31-24-16-10-17-25-31)32-26-18-11-19-27-32/h8-28,33-36,40H,1-7H3/t28-,33+,34-,35-,36+/m1/s1 |
| InChIKey | QTWAYBBANMMAAP-LICMVWMQSA-N |
| XLogP | 6.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.87 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|