C54H65IO5Si3 — CID 171122436
(2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-iodooxan-2-ol (PubChem CID 171122436) has the molecular formula C54H65IO5Si3 and a molecular weight of 1005.27 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-iodooxan-2-ol.
| Compound Name | (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-iodooxan-2-ol |
|---|---|
| PubChem CID | 171122436 |
| Molecular Formula | C54H65IO5Si3 |
| Molecular Weight | 1005.27 g/mol |
| Exact Mass | 1004.32 |
| IUPAC Name | (2S,3S,4S,5R,6R)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-iodooxan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](O)[C@@H](I)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H65IO5Si3/c1-52(2,3)61(41-28-16-10-17-29-41,42-30-18-11-19-31-42)57-40-47-49(59-62(53(4,5)6,43-32-20-12-21-33-43)44-34-22-13-23-35-44)50(48(55)51(56)58-47)60-63(54(7,8)9,45-36-24-14-25-37-45)46-38-26-15-27-39-46/h10-39,47-51,56H,40H2,1-9H3/t47-,48+,49-,50-,51+/m1/s1 |
| InChIKey | XCBRPJKVTWNDFK-DHHUHSCLSA-N |
| XLogP | 8.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.27 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|