C22H28O3Si — CID 10571070
(1R,4R,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxabicyclo[3.1.0]hexan-2-ol (PubChem CID 10571070) has the molecular formula C22H28O3Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (1R,4R,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,4R,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 10571070 |
| Molecular Formula | C22H28O3Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (1R,4R,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxabicyclo[3.1.0]hexan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OC(O)[C@@H]2C[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O3Si/c1-22(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)24-15-20-18-14-19(18)21(23)25-20/h4-13,18-21,23H,14-15H2,1-3H3/t18-,19+,20-,21?/m0/s1 |
| InChIKey | TUXNFCLUXGQZKC-HWPVKAJDSA-N |
| XLogP | 2.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|