C27H32O3SeSi — CID 10896506
(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylselanyloxolan-3-ol (PubChem CID 10896506) has the molecular formula C27H32O3SeSi and a molecular weight of 511.60 g/mol. Its IUPAC name is (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylselanyloxolan-3-ol.
| Compound Name | (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylselanyloxolan-3-ol |
|---|---|
| PubChem CID | 10896506 |
| Molecular Formula | C27H32O3SeSi |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylselanyloxolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC([Se]c2ccccc2)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O3SeSi/c1-27(2,3)32(22-15-9-5-10-16-22,23-17-11-6-12-18-23)29-20-25-24(28)19-26(30-25)31-21-13-7-4-8-14-21/h4-18,24-26,28H,19-20H2,1-3H3/t24-,25+,26?/m0/s1 |
| InChIKey | SFYLRRUKNNULTG-LHJLODMPSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|