C23H32O5Si — CID 11452775
(1R)-1-[(2S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]ethane-1,2-diol (PubChem CID 11452775) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is (1R)-1-[(2S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11452775 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1R)-1-[(2S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]ethane-1,2-diol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H]([C@H](O)CO)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32O5Si/c1-23(2,3)29(17-10-6-4-7-11-17,18-12-8-5-9-13-18)27-16-22-19(25)14-21(28-22)20(26)15-24/h4-13,19-22,24-26H,14-16H2,1-3H3/t19-,20+,21-,22+/m0/s1 |
| InChIKey | BIJBSKOWVCLGFZ-LNRXMEIDSA-N |
| XLogP | 1.43 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|