C23H30O3Si — CID 14824006
(1S)-1-[(2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]but-3-en-1-ol (PubChem CID 14824006) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is (1S)-1-[(2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]but-3-en-1-ol.
| Compound Name | (1S)-1-[(2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 14824006 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S)-1-[(2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@H](O)[C@@H]1O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H30O3Si/c1-5-12-20(24)22-21(26-22)17-25-27(23(2,3)4,18-13-8-6-9-14-18)19-15-10-7-11-16-19/h5-11,13-16,20-22,24H,1,12,17H2,2-4H3/t20-,21-,22-/m0/s1 |
| InChIKey | RIWQDLYIJTYNQZ-FKBYEOEOSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|