C44H60O4Si2 — CID 160880353
(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol;(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol (PubChem CID 160880353) has the molecular formula C44H60O4Si2 and a molecular weight of 709.13 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol;(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol.
| Compound Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol;(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 160880353 |
| Molecular Formula | C44H60O4Si2 |
| Molecular Weight | 709.13 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol;(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-en-1-ol |
| SMILES | C=CC[C@@H](CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.C=CC[C@H](CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/2C22H30O2Si/c2*1-5-12-19(17-23)18-24-25(22(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h2*5-11,13-16,19,23H,1,12,17-18H2,2-4H3/t2*19-/m10/s1 |
| InChIKey | SMYIKHWWMCEMDG-OYPHMNEHSA-N |
| XLogP | 7.50 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.13 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|