C21H30O3Si — CID 10904444
(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutane-1,2-diol (PubChem CID 10904444) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutane-1,2-diol.
| Compound Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 10904444 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutane-1,2-diol |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C21H30O3Si/c1-17(20(23)15-22)16-24-25(21(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20,22-23H,15-16H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | METJYGMUXLWHLT-YLJYHZDGSA-N |
| XLogP | 2.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|