C27H42O2Si2 — CID 162404498
(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methyl-5-(trimethylsilylmethyl)hex-5-en-3-ol (PubChem CID 162404498) has the molecular formula C27H42O2Si2 and a molecular weight of 454.80 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methyl-5-(trimethylsilylmethyl)hex-5-en-3-ol.
| Compound Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methyl-5-(trimethylsilylmethyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 162404498 |
| Molecular Formula | C27H42O2Si2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methyl-5-(trimethylsilylmethyl)hex-5-en-3-ol |
| SMILES | C=C(C[C@@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C27H42O2Si2/c1-22(21-30(6,7)8)19-26(28)23(2)20-29-31(27(3,4)5,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,23,26,28H,1,19-21H2,2-8H3/t23-,26-/m1/s1 |
| InChIKey | OMRWIYFKBIJDBR-ZEQKJWHPSA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|