C23H32O3Si — CID 101435848
(5S)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylidenehexane-1,5-diol (PubChem CID 101435848) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (5S)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylidenehexane-1,5-diol.
| Compound Name | (5S)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylidenehexane-1,5-diol |
|---|---|
| PubChem CID | 101435848 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (5S)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylidenehexane-1,5-diol |
| SMILES | C=C(CO)CC[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O3Si/c1-19(17-24)15-16-20(25)18-26-27(23(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,20,24-25H,1,15-18H2,2-4H3/t20-/m0/s1 |
| InChIKey | WMEMQSKJSLBBLR-FQEVSTJZSA-N |
| XLogP | 3.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|