C19H24O3Si — CID 11348036
(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropanal (PubChem CID 11348036) has the molecular formula C19H24O3Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropanal.
| Compound Name | (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropanal |
|---|---|
| PubChem CID | 11348036 |
| Molecular Formula | C19H24O3Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropanal |
| SMILES | CC(C)(C)[Si](OC[C@H](O)C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O3Si/c1-19(2,3)23(22-15-16(21)14-20,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-14,16,21H,15H2,1-3H3/t16-/m1/s1 |
| InChIKey | YYDCOOGZHHRUJP-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|