C26H30O3Si — CID 101456152
(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxypropanal (PubChem CID 101456152) has the molecular formula C26H30O3Si and a molecular weight of 418.61 g/mol. Its IUPAC name is (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxypropanal.
| Compound Name | (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxypropanal |
|---|---|
| PubChem CID | 101456152 |
| Molecular Formula | C26H30O3Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxypropanal |
| SMILES | CC(C)(C)[Si](OC[C@@H](C=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30O3Si/c1-26(2,3)30(24-15-9-5-10-16-24,25-17-11-6-12-18-25)29-21-23(19-27)28-20-22-13-7-4-8-14-22/h4-19,23H,20-21H2,1-3H3/t23-/m1/s1 |
| InChIKey | KDPBNVFSHHPVFX-HSZRJFAPSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|