C33H44O4Si — CID 23636317
(3R,4R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptanal (PubChem CID 23636317) has the molecular formula C33H44O4Si and a molecular weight of 532.80 g/mol. Its IUPAC name is (3R,4R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptanal.
| Compound Name | (3R,4R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptanal |
|---|---|
| PubChem CID | 23636317 |
| Molecular Formula | C33H44O4Si |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | (3R,4R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptanal |
| SMILES | COc1ccc(CO[C@H](CC=O)[C@H](C)C[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H44O4Si/c1-26(23-27(2)32(21-22-34)36-25-28-17-19-29(35-6)20-18-28)24-37-38(33(3,4)5,30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-20,22,26-27,32H,21,23-25H2,1-6H3/t26-,27+,32+/m0/s1 |
| InChIKey | HBKIZCMCYBJCMY-PYYUSEHKSA-N |
| XLogP | 6.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|