C41H52O5Si — CID 102089644
(2S,4S,5S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-1-phenylmethoxyoct-7-en-4-ol (PubChem CID 102089644) has the molecular formula C41H52O5Si and a molecular weight of 652.95 g/mol. Its IUPAC name is (2S,4S,5S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-1-phenylmethoxyoct-7-en-4-ol.
| Compound Name | (2S,4S,5S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-1-phenylmethoxyoct-7-en-4-ol |
|---|---|
| PubChem CID | 102089644 |
| Molecular Formula | C41H52O5Si |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | (2S,4S,5S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-1-phenylmethoxyoct-7-en-4-ol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](OCc1ccc(OC)cc1)[C@@H](O)C[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C41H52O5Si/c1-32(28-44-30-34-16-10-7-11-17-34)26-39(42)40(45-31-35-22-24-36(43-6)25-23-35)27-33(2)29-46-47(41(3,4)5,37-18-12-8-13-19-37)38-20-14-9-15-21-38/h7-25,32,39-40,42H,2,26-31H2,1,3-6H3/t32-,39-,40-/m0/s1 |
| InChIKey | AFPFOFXMDZJINT-BZFOWAFMSA-N |
| XLogP | 7.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|