C47H58O7SSi — CID 101483005
[(2S,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate (PubChem CID 101483005) has the molecular formula C47H58O7SSi and a molecular weight of 795.13 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101483005 |
| Molecular Formula | C47H58O7SSi |
| Molecular Weight | 795.13 g/mol |
| Exact Mass | 794.37 |
| IUPAC Name | [(2S,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CO[C@@H](C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)COCc2ccccc2)[C@@H](C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C47H58O7SSi/c1-36-23-29-42(30-24-36)55(48,49)53-33-38(3)45(52-35-40-25-27-41(50-7)28-26-40)31-46(37(2)32-51-34-39-17-11-8-12-18-39)54-56(47(4,5)6,43-19-13-9-14-20-43)44-21-15-10-16-22-44/h8-30,37-38,45-46H,31-35H2,1-7H3/t37-,38+,45+,46+/m1/s1 |
| InChIKey | AWJMXSQQYGLPHP-OKQMFERJSA-N |
| XLogP | 9.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.13 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|