C30H38O10S2 — CID 101238588
[(2R,3R)-2-(2-ethoxyethoxy)-3-[(4-methoxyphenyl)methoxy]-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 101238588) has the molecular formula C30H38O10S2 and a molecular weight of 622.76 g/mol. Its IUPAC name is [(2R,3R)-2-(2-ethoxyethoxy)-3-[(4-methoxyphenyl)methoxy]-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-2-(2-ethoxyethoxy)-3-[(4-methoxyphenyl)methoxy]-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101238588 |
| Molecular Formula | C30H38O10S2 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | [(2R,3R)-2-(2-ethoxyethoxy)-3-[(4-methoxyphenyl)methoxy]-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | CCOCCO[C@H](COS(=O)(=O)c1ccc(C)cc1)[C@@H](COS(=O)(=O)c1ccc(C)cc1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H38O10S2/c1-5-36-18-19-37-29(21-39-41(31,32)27-14-6-23(2)7-15-27)30(38-20-25-10-12-26(35-4)13-11-25)22-40-42(33,34)28-16-8-24(3)9-17-28/h6-17,29-30H,5,18-22H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | YYLXYBMVYGIINL-LOYHVIPDSA-N |
| XLogP | 4.43 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|