C20H26O5S — CID 134962077
[(2S,3R)-3-[(4-methoxyphenyl)methoxy]-2-methylbutyl] 4-methylbenzenesulfonate (PubChem CID 134962077) has the molecular formula C20H26O5S and a molecular weight of 378.49 g/mol. Its IUPAC name is [(2S,3R)-3-[(4-methoxyphenyl)methoxy]-2-methylbutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R)-3-[(4-methoxyphenyl)methoxy]-2-methylbutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134962077 |
| Molecular Formula | C20H26O5S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(2S,3R)-3-[(4-methoxyphenyl)methoxy]-2-methylbutyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CO[C@H](C)[C@@H](C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26O5S/c1-15-5-11-20(12-6-15)26(21,22)25-13-16(2)17(3)24-14-18-7-9-19(23-4)10-8-18/h5-12,16-17H,13-14H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | ZYWUQUAIOHSFOC-DLBZAZTESA-N |
| XLogP | 3.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|