C13H20O4S — CID 59131945
[(2R,3S)-2-hydroxy-3-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 59131945) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is [(2R,3S)-2-hydroxy-3-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-hydroxy-3-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59131945 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [(2R,3S)-2-hydroxy-3-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@H](C)[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H20O4S/c1-4-11(3)13(14)9-17-18(15,16)12-7-5-10(2)6-8-12/h5-8,11,13-14H,4,9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | FVDCXFDGYVSZCT-AAEUAGOBSA-N |
| XLogP | 2.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|