C12H18O5S — CID 14237203
2,3-dihydroxypentyl 4-methylbenzenesulfonate (PubChem CID 14237203) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2,3-dihydroxypentyl 4-methylbenzenesulfonate.
| Compound Name | 2,3-dihydroxypentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14237203 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,3-dihydroxypentyl 4-methylbenzenesulfonate |
| SMILES | CCC(O)C(O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-3-11(13)12(14)8-17-18(15,16)10-6-4-9(2)5-7-10/h4-7,11-14H,3,8H2,1-2H3 |
| InChIKey | RENLIALMXJYBAP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|