C11H15BrO4S — CID 134993248
[(2S,3R)-2-bromo-3-hydroxybutyl] 4-methylbenzenesulfonate (PubChem CID 134993248) has the molecular formula C11H15BrO4S and a molecular weight of 323.21 g/mol. Its IUPAC name is [(2S,3R)-2-bromo-3-hydroxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R)-2-bromo-3-hydroxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134993248 |
| Molecular Formula | C11H15BrO4S |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [(2S,3R)-2-bromo-3-hydroxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](Br)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C11H15BrO4S/c1-8-3-5-10(6-4-8)17(14,15)16-7-11(12)9(2)13/h3-6,9,11,13H,7H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | CDCAIAYCKCYSBJ-KOLCDFICSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|