C15H24O6S — CID 89360381
[(3R,4R)-3,4-dihydroxy-2-propan-2-yloxypentyl] 4-methylbenzenesulfonate (PubChem CID 89360381) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is [(3R,4R)-3,4-dihydroxy-2-propan-2-yloxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,4R)-3,4-dihydroxy-2-propan-2-yloxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89360381 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(3R,4R)-3,4-dihydroxy-2-propan-2-yloxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(OC(C)C)[C@H](O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H24O6S/c1-10(2)21-14(15(17)12(4)16)9-20-22(18,19)13-7-5-11(3)6-8-13/h5-8,10,12,14-17H,9H2,1-4H3/t12-,14?,15-/m1/s1 |
| InChIKey | YIKSJKAONCWUEH-SULGFLJSSA-N |
| XLogP | 1.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|